C10H18O — CID 13468573
(7,7-dimethyl-3-bicyclo[4.1.0]heptanyl)methanol (PubChem CID 13468573) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (7,7-dimethyl-3-bicyclo[4.1.0]heptanyl)methanol.
| Compound Name | (7,7-dimethyl-3-bicyclo[4.1.0]heptanyl)methanol |
|---|---|
| PubChem CID | 13468573 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (7,7-dimethyl-3-bicyclo[4.1.0]heptanyl)methanol |
| SMILES | CC1(C)C2CCC(CO)CC21 |
| InChI | InChI=1S/C10H18O/c1-10(2)8-4-3-7(6-11)5-9(8)10/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | RUNQEPRTFSMVNH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |