C18H12O4 — CID 134716325
4-[(1-oxo-2,3-dihydroinden-5-yl)oxy]chromen-2-one (PubChem CID 134716325) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[(1-oxo-2,3-dihydroinden-5-yl)oxy]chromen-2-one.
| Compound Name | 4-[(1-oxo-2,3-dihydroinden-5-yl)oxy]chromen-2-one |
|---|---|
| PubChem CID | 134716325 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[(1-oxo-2,3-dihydroinden-5-yl)oxy]chromen-2-one |
| SMILES | O=C1CCc2cc(Oc3cc(=O)oc4ccccc34)ccc21 |
| InChI | InChI=1S/C18H12O4/c19-15-8-5-11-9-12(6-7-13(11)15)21-17-10-18(20)22-16-4-2-1-3-14(16)17/h1-4,6-7,9-10H,5,8H2 |
| InChIKey | VTMVDNJUKUIJCW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|