C41H73O8P — CID 134725228
[(2R)-2-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (E)-icos-11-enoate (PubChem CID 134725228) has the molecular formula C41H73O8P and a molecular weight of 725.00 g/mol. Its IUPAC name is [(2R)-2-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (E)-icos-11-enoate.
| Compound Name | [(2R)-2-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 134725228 |
| Molecular Formula | C41H73O8P |
| Molecular Weight | 725.00 g/mol |
| Exact Mass | 724.50 |
| IUPAC Name | [(2R)-2-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (E)-icos-11-enoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/CCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C41H73O8P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-40(42)47-37-39(38-48-50(44,45)46)49-41(43)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h12,14,17-19,21,26,28,39H,3-11,13,15-16,20,22-25,27,29-38H2,1-2H3,(H2,44,45,46)/b14-12+,19-17+,21-18+,28-26+/t39-/m1/s1 |
| InChIKey | CTZIFPVLQHRRDD-PBIMMWMCSA-N |
| XLogP | 11.96 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.00 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|