C19H14N2O3S — CID 13472608
2,4-bis(4-methoxyphenyl)-6-oxo-1,3-thiazine-5-carbonitrile (PubChem CID 13472608) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenyl)-6-oxo-1,3-thiazine-5-carbonitrile.
| Compound Name | 2,4-bis(4-methoxyphenyl)-6-oxo-1,3-thiazine-5-carbonitrile |
|---|---|
| PubChem CID | 13472608 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2,4-bis(4-methoxyphenyl)-6-oxo-1,3-thiazine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(-c3ccc(OC)cc3)c(C#N)c(=O)s2)cc1 |
| InChI | InChI=1S/C19H14N2O3S/c1-23-14-7-3-12(4-8-14)17-16(11-20)19(22)25-18(21-17)13-5-9-15(24-2)10-6-13/h3-10H,1-2H3 |
| InChIKey | UAHSTTHWBURVPN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |