C22H20FN3O3S — CID 134807834
CID 134807834 (PubChem CID 134807834) has the molecular formula C22H20FN3O3S and a molecular weight of 425.49 g/mol.
| Compound Name | CID 134807834 |
|---|---|
| PubChem CID | 134807834 |
| Molecular Formula | C22H20FN3O3S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | — |
| SMILES | O=C(Nc1cccnc1)[C@@H]1C[C@@H](c2ccc(F)cc2)N([S+](=O)([O-])c2ccccc2)C1 |
| InChI | InChI=1S/C22H20FN3O3S/c23-18-10-8-16(9-11-18)21-13-17(22(27)25-19-5-4-12-24-14-19)15-26(21)30(28,29)20-6-2-1-3-7-20/h1-12,14,17,21H,13,15H2,(H-,25,27,28,29)/t17-,21+/m1/s1 |
| InChIKey | VBPDZJOVZRNQPS-UTKZUKDTSA-N |
| XLogP | 3.83 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|