C20H22FN3O3S — CID 134810513
CID 134810513 (PubChem CID 134810513) has the molecular formula C20H22FN3O3S and a molecular weight of 403.48 g/mol.
| Compound Name | CID 134810513 |
|---|---|
| PubChem CID | 134810513 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | — |
| SMILES | CN(C(=O)[C@@H]1C[C@H](c2ccc(F)cc2)N([S+](=O)([O-])C2CC2)C1)c1cccnc1 |
| InChI | InChI=1S/C20H22FN3O3S/c1-23(17-3-2-10-22-12-17)20(25)15-11-19(14-4-6-16(21)7-5-14)24(13-15)28(26,27)18-8-9-18/h2-7,10,12,15,18-19H,8-9,11,13H2,1H3/t15-,19-/m1/s1 |
| InChIKey | FIMHPWJFSVHTRR-DNVCBOLYSA-N |
| XLogP | 2.95 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|