C24H24FN3O3S — CID 134810124
CID 134810124 (PubChem CID 134810124) has the molecular formula C24H24FN3O3S and a molecular weight of 453.54 g/mol.
| Compound Name | CID 134810124 |
|---|---|
| PubChem CID | 134810124 |
| Molecular Formula | C24H24FN3O3S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | — |
| SMILES | O=C(NCCc1ccccc1)[C@@H]1C[C@@H](c2ccc(F)cc2)N([S+](=O)([O-])c2cccnc2)C1 |
| InChI | InChI=1S/C24H24FN3O3S/c25-21-10-8-19(9-11-21)23-15-20(24(29)27-14-12-18-5-2-1-3-6-18)17-28(23)32(30,31)22-7-4-13-26-16-22/h1-11,13,16,20,23H,12,14-15,17H2,(H-,27,29,30,31)/t20-,23+/m1/s1 |
| InChIKey | GDPZMPGWZSTWLX-OFNKIYASSA-N |
| XLogP | 3.55 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|