C20H21IO4 — CID 134812873
3-[3-[(4-iodophenyl)methoxy]propyl]-7-methoxy-3,4-dihydroisochromen-1-one (PubChem CID 134812873) has the molecular formula C20H21IO4 and a molecular weight of 452.29 g/mol. Its IUPAC name is 3-[3-[(4-iodophenyl)methoxy]propyl]-7-methoxy-3,4-dihydroisochromen-1-one.
| Compound Name | 3-[3-[(4-iodophenyl)methoxy]propyl]-7-methoxy-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 134812873 |
| Molecular Formula | C20H21IO4 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 3-[3-[(4-iodophenyl)methoxy]propyl]-7-methoxy-3,4-dihydroisochromen-1-one |
| SMILES | COc1ccc2c(c1)C(=O)OC(CCCOCc1ccc(I)cc1)C2 |
| InChI | InChI=1S/C20H21IO4/c1-23-17-9-6-15-11-18(25-20(22)19(15)12-17)3-2-10-24-13-14-4-7-16(21)8-5-14/h4-9,12,18H,2-3,10-11,13H2,1H3 |
| InChIKey | FOPAAYRFEVQJFP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|