C27H39NOSi — CID 134813832
(3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-7-phenyl-N-[(1R)-1-phenylethyl]hepta-1,4-dien-3-amine (PubChem CID 134813832) has the molecular formula C27H39NOSi and a molecular weight of 421.70 g/mol. Its IUPAC name is (3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-7-phenyl-N-[(1R)-1-phenylethyl]hepta-1,4-dien-3-amine.
| Compound Name | (3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-7-phenyl-N-[(1R)-1-phenylethyl]hepta-1,4-dien-3-amine |
|---|---|
| PubChem CID | 134813832 |
| Molecular Formula | C27H39NOSi |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | (3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-7-phenyl-N-[(1R)-1-phenylethyl]hepta-1,4-dien-3-amine |
| SMILES | C=C[C@H](N[C@H](C)c1ccccc1)/C(=C/CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H39NOSi/c1-8-25(28-22(2)24-19-13-10-14-20-24)26(29-30(6,7)27(3,4)5)21-15-18-23-16-11-9-12-17-23/h8-14,16-17,19-22,25,28H,1,15,18H2,2-7H3/b26-21-/t22-,25+/m1/s1 |
| InChIKey | WIZVYFSUZDUBQO-BVAWCNAGSA-N |
| XLogP | 7.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|