C16H12N2 — CID 134820650
3-methyl-2H-phenanthro[9,10-c]pyrazole (PubChem CID 134820650) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 3-methyl-2H-phenanthro[9,10-c]pyrazole.
| Compound Name | 3-methyl-2H-phenanthro[9,10-c]pyrazole |
|---|---|
| PubChem CID | 134820650 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-methyl-2H-phenanthro[9,10-c]pyrazole |
| SMILES | Cc1[nH]nc2c3ccccc3c3ccccc3c12 |
| InChI | InChI=1S/C16H12N2/c1-10-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)16(15)18-17-10/h2-9H,1H3,(H,17,18) |
| InChIKey | JAWQIDDLHHHKFO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|