About 3-methyl-2H-phenanthro[9,10-c]pyrazole
3-methyl-2H-phenanthro[9,10-c]pyrazole (PubChem CID 134820650) has the molecular formula C16H12N2
and a molecular weight of 232.29 g/mol. Its IUPAC name is 3-methyl-2H-phenanthro[9,10-c]pyrazole.
Molecular Properties
| Compound Name | 3-methyl-2H-phenanthro[9,10-c]pyrazole |
| PubChem CID | 134820650 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-methyl-2H-phenanthro[9,10-c]pyrazole |
| SMILES | Cc1[nH]nc2c3ccccc3c3ccccc3c12 |
| InChI | InChI=1S/C16H12N2/c1-10-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)16(15)18-17-10/h2-9H,1H3,(H,17,18) |
| InChIKey | JAWQIDDLHHHKFO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2H-phenanthro[9,10-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2H-phenanthro[9,10-c]pyrazole?
The IUPAC name of 3-methyl-2H-phenanthro[9,10-c]pyrazole (CID 134820650) is 3-methyl-2H-phenanthro[9,10-c]pyrazole.
What is the SMILES notation for 3-methyl-2H-phenanthro[9,10-c]pyrazole?
The canonical SMILES for 3-methyl-2H-phenanthro[9,10-c]pyrazole is Cc1[nH]nc2c3ccccc3c3ccccc3c12.
What is the InChIKey of 3-methyl-2H-phenanthro[9,10-c]pyrazole?
The InChIKey is JAWQIDDLHHHKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2/c1-10-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)16(15)18-17-10/h2-9H,1H3,(H,17,18).
What are the key properties of 3-methyl-2H-phenanthro[9,10-c]pyrazole?
3-methyl-2H-phenanthro[9,10-c]pyrazole has a molecular weight of 232.29 g/mol, XLogP of 4.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2H-phenanthro[9,10-c]pyrazole is sourced from PubChem (CID 134820650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).