C19H16N2O3S — CID 134822355
(Z)-4-hydroxy-N-(6-methyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)-2-oxobut-3-enamide (PubChem CID 134822355) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is (Z)-4-hydroxy-N-(6-methyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)-2-oxobut-3-enamide.
| Compound Name | (Z)-4-hydroxy-N-(6-methyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)-2-oxobut-3-enamide |
|---|---|
| PubChem CID | 134822355 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (Z)-4-hydroxy-N-(6-methyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)-2-oxobut-3-enamide |
| SMILES | Cc1ccc(/C(O)=C/C(=O)C(=O)Nc2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C19H16N2O3S/c1-11-3-6-13(7-4-11)15(22)10-16(23)18(24)21-19-20-14-8-5-12(2)9-17(14)25-19/h3-10,22H,1-2H3,(H,20,21,24)/b15-10- |
| InChIKey | YDROKZREFGWDFY-GDNBJRDFSA-N |
| XLogP | 4.02 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|