C24H27F3NO4P — CID 134823398
5-[4-[3-[3-(2,2,2-trifluoroacetyl)indol-1-yl]propyl]phenyl]pentylphosphonic acid (PubChem CID 134823398) has the molecular formula C24H27F3NO4P and a molecular weight of 481.45 g/mol. Its IUPAC name is 5-[4-[3-[3-(2,2,2-trifluoroacetyl)indol-1-yl]propyl]phenyl]pentylphosphonic acid.
| Compound Name | 5-[4-[3-[3-(2,2,2-trifluoroacetyl)indol-1-yl]propyl]phenyl]pentylphosphonic acid |
|---|---|
| PubChem CID | 134823398 |
| Molecular Formula | C24H27F3NO4P |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 5-[4-[3-[3-(2,2,2-trifluoroacetyl)indol-1-yl]propyl]phenyl]pentylphosphonic acid |
| SMILES | O=C(c1cn(CCCc2ccc(CCCCCP(=O)(O)O)cc2)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C24H27F3NO4P/c25-24(26,27)23(29)21-17-28(22-10-4-3-9-20(21)22)15-6-8-19-13-11-18(12-14-19)7-2-1-5-16-33(30,31)32/h3-4,9-14,17H,1-2,5-8,15-16H2,(H2,30,31,32) |
| InChIKey | JVEOGAOFYAJGMI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|