C16H20N2O3 — CID 134831395
(1R,5R,8S)-3,7,8-tris(prop-2-enyl)-3,7-diazabicyclo[3.3.1]nonane-2,4,6-trione (PubChem CID 134831395) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1R,5R,8S)-3,7,8-tris(prop-2-enyl)-3,7-diazabicyclo[3.3.1]nonane-2,4,6-trione.
| Compound Name | (1R,5R,8S)-3,7,8-tris(prop-2-enyl)-3,7-diazabicyclo[3.3.1]nonane-2,4,6-trione |
|---|---|
| PubChem CID | 134831395 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (1R,5R,8S)-3,7,8-tris(prop-2-enyl)-3,7-diazabicyclo[3.3.1]nonane-2,4,6-trione |
| SMILES | C=CC[C@H]1[C@H]2C[C@@H](C(=O)N(CC=C)C2=O)C(=O)N1CC=C |
| InChI | InChI=1S/C16H20N2O3/c1-4-7-13-11-10-12(15(20)17(13)8-5-2)16(21)18(9-6-3)14(11)19/h4-6,11-13H,1-3,7-10H2/t11-,12-,13+/m1/s1 |
| InChIKey | AVOZFAAACGUACI-UPJWGTAASA-N |
| XLogP | 1.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|