C19H25NO2SSe — CID 134831566
4-methyl-N-[(3R,4R)-2-methyl-4-phenylselanylpentan-3-yl]benzenesulfonamide (PubChem CID 134831566) has the molecular formula C19H25NO2SSe and a molecular weight of 410.44 g/mol. Its IUPAC name is 4-methyl-N-[(3R,4R)-2-methyl-4-phenylselanylpentan-3-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(3R,4R)-2-methyl-4-phenylselanylpentan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134831566 |
| Molecular Formula | C19H25NO2SSe |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 4-methyl-N-[(3R,4R)-2-methyl-4-phenylselanylpentan-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C(C)C)[C@@H](C)[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C19H25NO2SSe/c1-14(2)19(16(4)24-18-8-6-5-7-9-18)20-23(21,22)17-12-10-15(3)11-13-17/h5-14,16,19-20H,1-4H3/t16-,19-/m1/s1 |
| InChIKey | BHBGOFALFVSGBA-VQIMIIECSA-N |
| XLogP | 3.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|