C18H32O8Si — CID 134831855
[(3R,6R)-4,5-diacetyloxy-6-[[diethyl(methyl)silyl]oxymethyl]-2-methyloxan-3-yl] acetate (PubChem CID 134831855) has the molecular formula C18H32O8Si and a molecular weight of 404.53 g/mol. Its IUPAC name is [(3R,6R)-4,5-diacetyloxy-6-[[diethyl(methyl)silyl]oxymethyl]-2-methyloxan-3-yl] acetate.
| Compound Name | [(3R,6R)-4,5-diacetyloxy-6-[[diethyl(methyl)silyl]oxymethyl]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 134831855 |
| Molecular Formula | C18H32O8Si |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [(3R,6R)-4,5-diacetyloxy-6-[[diethyl(methyl)silyl]oxymethyl]-2-methyloxan-3-yl] acetate |
| SMILES | CC[Si](C)(CC)OC[C@H]1OC(C)[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H32O8Si/c1-8-27(7,9-2)22-10-15-17(25-13(5)20)18(26-14(6)21)16(11(3)23-15)24-12(4)19/h11,15-18H,8-10H2,1-7H3/t11?,15-,16-,17?,18?/m1/s1 |
| InChIKey | QBUFOAYSKGSITK-JPTZAXLBSA-N |
| XLogP | 2.20 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|