C16H24O5 — CID 134832472
tert-butyl (2Z)-2-[(3aS,6R,6aS)-2,2-dimethyl-6-[(E)-prop-1-enyl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate (PubChem CID 134832472) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[(3aS,6R,6aS)-2,2-dimethyl-6-[(E)-prop-1-enyl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate.
| Compound Name | tert-butyl (2Z)-2-[(3aS,6R,6aS)-2,2-dimethyl-6-[(E)-prop-1-enyl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate |
|---|---|
| PubChem CID | 134832472 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl (2Z)-2-[(3aS,6R,6aS)-2,2-dimethyl-6-[(E)-prop-1-enyl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate |
| SMILES | C/C=C/[C@H]1O/C(=C\C(=O)OC(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C16H24O5/c1-7-8-10-13-14(21-16(5,6)20-13)11(18-10)9-12(17)19-15(2,3)4/h7-10,13-14H,1-6H3/b8-7+,11-9-/t10-,13+,14-/m1/s1 |
| InChIKey | NNRIAPDVONIRDM-FZVLDBMLSA-N |
| XLogP | 2.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|