C16H22O2 — CID 134832764
(8'aS,10'aS)-spiro[1,3-dioxolane-2,8'-2,3,4,5,6,7,8a,10a-octahydro-1H-anthracene] (PubChem CID 134832764) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (8'aS,10'aS)-spiro[1,3-dioxolane-2,8'-2,3,4,5,6,7,8a,10a-octahydro-1H-anthracene].
| Compound Name | (8'aS,10'aS)-spiro[1,3-dioxolane-2,8'-2,3,4,5,6,7,8a,10a-octahydro-1H-anthracene] |
|---|---|
| PubChem CID | 134832764 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (8'aS,10'aS)-spiro[1,3-dioxolane-2,8'-2,3,4,5,6,7,8a,10a-octahydro-1H-anthracene] |
| SMILES | C1=C2CCCCC2=C[C@@H]2[C@H]1CCCC21OCCO1 |
| InChI | InChI=1S/C16H22O2/c1-2-5-13-11-15-14(10-12(13)4-1)6-3-7-16(15)17-8-9-18-16/h10-11,14-15H,1-9H2/t14-,15+/m0/s1 |
| InChIKey | HXIFEUXZHIELLV-LSDHHAIUSA-N |
| XLogP | 3.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |