C20H34O2 — CID 142265663
4,8'-dimethylspiro[1,3-dioxolane-2,7'-2,3,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthrene];ethane (PubChem CID 142265663) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 4,8'-dimethylspiro[1,3-dioxolane-2,7'-2,3,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthrene];ethane.
| Compound Name | 4,8'-dimethylspiro[1,3-dioxolane-2,7'-2,3,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthrene];ethane |
|---|---|
| PubChem CID | 142265663 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 4,8'-dimethylspiro[1,3-dioxolane-2,7'-2,3,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthrene];ethane |
| SMILES | CC.CC1COC2(CCC3C4=CCCCC4CCC3C2C)O1 |
| InChI | InChI=1S/C18H28O2.C2H6/c1-12-11-19-18(20-12)10-9-17-15(13(18)2)8-7-14-5-3-4-6-16(14)17;1-2/h6,12-15,17H,3-5,7-11H2,1-2H3;1-2H3 |
| InChIKey | XNGBEGMIMIBBJT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|