C14H22O2 — CID 134979833
(4'aR,8'aS)-6',7'-dimethylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydro-1H-naphthalene] (PubChem CID 134979833) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (4'aR,8'aS)-6',7'-dimethylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydro-1H-naphthalene].
| Compound Name | (4'aR,8'aS)-6',7'-dimethylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 134979833 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (4'aR,8'aS)-6',7'-dimethylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydro-1H-naphthalene] |
| SMILES | CC1=C(C)C[C@@H]2[C@@H](CCCC23OCCO3)C1 |
| InChI | InChI=1S/C14H22O2/c1-10-8-12-4-3-5-14(15-6-7-16-14)13(12)9-11(10)2/h12-13H,3-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | NFPIBVYYTSPGJZ-QWHCGFSZSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|