C17H26O2 — CID 143311552
(2R,8R,8aS)-8,8a-dimethyl-2-prop-1-en-2-ylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane] (PubChem CID 143311552) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (2R,8R,8aS)-8,8a-dimethyl-2-prop-1-en-2-ylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane].
| Compound Name | (2R,8R,8aS)-8,8a-dimethyl-2-prop-1-en-2-ylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 143311552 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (2R,8R,8aS)-8,8a-dimethyl-2-prop-1-en-2-ylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane] |
| SMILES | C=C(C)[C@@H]1CC=C2CC3(C[C@@H](C)[C@]2(C)C1)OCCO3 |
| InChI | InChI=1S/C17H26O2/c1-12(2)14-5-6-15-11-17(18-7-8-19-17)9-13(3)16(15,4)10-14/h6,13-14H,1,5,7-11H2,2-4H3/t13-,14-,16+/m1/s1 |
| InChIKey | ZDVUFPBLAQLDJS-FMKPAKJESA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|