C15H24O2 — CID 134965943
2-[(4aS)-6,7-dimethyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-yl]-1,3-dioxolane (PubChem CID 134965943) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-[(4aS)-6,7-dimethyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-yl]-1,3-dioxolane.
| Compound Name | 2-[(4aS)-6,7-dimethyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 134965943 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-[(4aS)-6,7-dimethyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-yl]-1,3-dioxolane |
| SMILES | CC1=C(C)C[C@@]2(C3OCCO3)CCCCC2C1 |
| InChI | InChI=1S/C15H24O2/c1-11-9-13-5-3-4-6-15(13,10-12(11)2)14-16-7-8-17-14/h13-14H,3-10H2,1-2H3/t13?,15-/m0/s1 |
| InChIKey | CGFQNDHNTYZARP-WUJWULDRSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|