About 2-methylbut-2-ene
2-methylbut-2-ene (PubChem CID 134832871) has the molecular formula C5H9-
and a molecular weight of 69.13 g/mol. Its IUPAC name is 2-methylbut-2-ene.
Molecular Properties
| Compound Name | 2-methylbut-2-ene |
| PubChem CID | 134832871 |
| Molecular Formula | C5H9- |
| Molecular Weight | 69.13 g/mol |
| Exact Mass | 69.07 |
| IUPAC Name | 2-methylbut-2-ene |
| SMILES | C[C-]=C(C)C |
| InChI | InChI=1S/C5H9/c1-4-5(2)3/h1-3H3/q-1 |
| InChIKey | PLFKOCWHCXWUGK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 69.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-ene?
The IUPAC name of 2-methylbut-2-ene (CID 134832871) is 2-methylbut-2-ene.
What is the SMILES notation for 2-methylbut-2-ene?
The canonical SMILES for 2-methylbut-2-ene is C[C-]=C(C)C.
What is the InChIKey of 2-methylbut-2-ene?
The InChIKey is PLFKOCWHCXWUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9/c1-4-5(2)3/h1-3H3/q-1.
What are the key properties of 2-methylbut-2-ene?
2-methylbut-2-ene has a molecular weight of 69.13 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-ene is sourced from PubChem (CID 134832871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).