C15H26O5 — CID 134833026
(6R,9S)-4,4,11,11-tetramethyl-8-(2-methylpropyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 134833026) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (6R,9S)-4,4,11,11-tetramethyl-8-(2-methylpropyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (6R,9S)-4,4,11,11-tetramethyl-8-(2-methylpropyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 134833026 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (6R,9S)-4,4,11,11-tetramethyl-8-(2-methylpropyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC(C)CC1O[C@@H]2OC(C)(C)OC2C2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H26O5/c1-8(2)7-9-10-11(18-14(3,4)17-10)12-13(16-9)20-15(5,6)19-12/h8-13H,7H2,1-6H3/t9?,10-,11?,12?,13+/m0/s1 |
| InChIKey | FHGHYWOZHQAWJY-ZHYIQUJTSA-N |
| XLogP | 2.43 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |