C19H27N3O5 — CID 134833131
(4S,5S)-4-[(2S,3S,4S,5S)-4-azido-5-methoxy-3-methyloxolan-2-yl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane (PubChem CID 134833131) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is (4S,5S)-4-[(2S,3S,4S,5S)-4-azido-5-methoxy-3-methyloxolan-2-yl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane.
| Compound Name | (4S,5S)-4-[(2S,3S,4S,5S)-4-azido-5-methoxy-3-methyloxolan-2-yl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 134833131 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (4S,5S)-4-[(2S,3S,4S,5S)-4-azido-5-methoxy-3-methyloxolan-2-yl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane |
| SMILES | CO[C@H]1O[C@H]([C@@H]2OC(C)(C)O[C@H]2COCc2ccccc2)[C@@H](C)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C19H27N3O5/c1-12-15(21-22-20)18(23-4)25-16(12)17-14(26-19(2,3)27-17)11-24-10-13-8-6-5-7-9-13/h5-9,12,14-18H,10-11H2,1-4H3/t12-,14-,15-,16-,17+,18-/m0/s1 |
| InChIKey | BFQRCGBBIYVTHY-BULOIVJKSA-N |
| XLogP | 3.41 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|