C34H42O4S — CID 134836065
[(1R,4aS)-1,4a-dimethyl-6-phenylmethoxy-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134836065) has the molecular formula C34H42O4S and a molecular weight of 546.77 g/mol. Its IUPAC name is [(1R,4aS)-1,4a-dimethyl-6-phenylmethoxy-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,4aS)-1,4a-dimethyl-6-phenylmethoxy-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134836065 |
| Molecular Formula | C34H42O4S |
| Molecular Weight | 546.77 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [(1R,4aS)-1,4a-dimethyl-6-phenylmethoxy-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(C)CCC[C@]3(C)c4cc(OCc5ccccc5)c(C(C)C)cc4CCC23)cc1 |
| InChI | InChI=1S/C34H42O4S/c1-24(2)29-20-27-14-17-32-33(4,23-38-39(35,36)28-15-12-25(3)13-16-28)18-9-19-34(32,5)30(27)21-31(29)37-22-26-10-7-6-8-11-26/h6-8,10-13,15-16,20-21,24,32H,9,14,17-19,22-23H2,1-5H3/t32?,33-,34+/m0/s1 |
| InChIKey | IKNVJDFLVYDNOB-PRIWKQAOSA-N |
| XLogP | 8.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.77 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|