C30H29NO7S — CID 134836776
(NE)-N-[3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]chromen-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 134836776) has the molecular formula C30H29NO7S and a molecular weight of 547.63 g/mol. Its IUPAC name is (NE)-N-[3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]chromen-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]chromen-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134836776 |
| Molecular Formula | C30H29NO7S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | (NE)-N-[3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]chromen-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=c2/oc3ccccc3cc2[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29NO7S/c1-19-13-15-22(16-14-19)39(32,33)31-28-23(17-21-11-7-8-12-24(21)35-28)25-26(34-18-20-9-5-4-6-10-20)27-29(36-25)38-30(2,3)37-27/h4-17,25-27,29H,18H2,1-3H3/b31-28+/t25-,26+,27-,29-/m1/s1 |
| InChIKey | FBPPQOSUAAKCHK-IJMCABHBSA-N |
| XLogP | 5.17 |
| TPSA | 96.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |