C34H33N2O2+ — CID 134837264
[(S)-(5-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl] anthracene-9-carboxylate (PubChem CID 134837264) has the molecular formula C34H33N2O2+ and a molecular weight of 501.65 g/mol. Its IUPAC name is [(S)-(5-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl] anthracene-9-carboxylate.
| Compound Name | [(S)-(5-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 134837264 |
| Molecular Formula | C34H33N2O2+ |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [(S)-(5-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl] anthracene-9-carboxylate |
| SMILES | CCC1C[NH+]2CCC1CC2[C@@H](OC(=O)c1c2ccccc2cc2ccccc12)c1ccnc2ccccc12 |
| InChI | InChI=1S/C34H32N2O2/c1-2-22-21-36-18-16-23(22)20-31(36)33(29-15-17-35-30-14-8-7-13-28(29)30)38-34(37)32-26-11-5-3-9-24(26)19-25-10-4-6-12-27(25)32/h3-15,17,19,22-23,31,33H,2,16,18,20-21H2,1H3/p+1/t22?,23?,31?,33-/m0/s1 |
| InChIKey | LKVPDKDDZRQOMJ-DTNQSTGMSA-O |
| XLogP | 6.14 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|