C37H55NO5Si — CID 134839981
(1R,6R,10R,12E,14S,17S,18S)-20-acetyl-19-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-10,16,17-trimethyl-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-12,15-diene-3,21-dione (PubChem CID 134839981) has the molecular formula C37H55NO5Si and a molecular weight of 621.94 g/mol. Its IUPAC name is (1R,6R,10R,12E,14S,17S,18S)-20-acetyl-19-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-10,16,17-trimethyl-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-12,15-diene-3,21-dione.
| Compound Name | (1R,6R,10R,12E,14S,17S,18S)-20-acetyl-19-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-10,16,17-trimethyl-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-12,15-diene-3,21-dione |
|---|---|
| PubChem CID | 134839981 |
| Molecular Formula | C37H55NO5Si |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.38 |
| IUPAC Name | (1R,6R,10R,12E,14S,17S,18S)-20-acetyl-19-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-10,16,17-trimethyl-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-12,15-diene-3,21-dione |
| SMILES | CC(=O)N1C(=O)[C@@]23OC(=O)CC[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@@H](C)C/C=C/[C@H]2C=C(C)[C@@H](C)[C@H]3C1Cc1ccccc1 |
| InChI | InChI=1S/C37H55NO5Si/c1-25-15-13-19-30-23-26(2)27(3)34-32(24-29-17-11-10-12-18-29)38(28(4)39)35(41)37(30,34)42-33(40)22-21-31(20-14-16-25)43-44(8,9)36(5,6)7/h10-13,17-19,23,25,27,30-32,34H,14-16,20-22,24H2,1-9H3/b19-13+/t25-,27+,30-,31+,32?,34-,37+/m0/s1 |
| InChIKey | YPWNHHXFZYLOOG-PIELNWTESA-N |
| XLogP | 8.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|