C37H55NO5Si — CID 134839807
(1-acetyl-2-benzyl-5-oxo-2H-pyrrol-4-yl) (4R,8R,10E,12E,14E)-4-[tert-butyl(dimethyl)silyl]oxy-8,14-dimethylhexadeca-10,12,14-trienoate (PubChem CID 134839807) has the molecular formula C37H55NO5Si and a molecular weight of 621.94 g/mol. Its IUPAC name is (1-acetyl-2-benzyl-5-oxo-2H-pyrrol-4-yl) (4R,8R,10E,12E,14E)-4-[tert-butyl(dimethyl)silyl]oxy-8,14-dimethylhexadeca-10,12,14-trienoate.
| Compound Name | (1-acetyl-2-benzyl-5-oxo-2H-pyrrol-4-yl) (4R,8R,10E,12E,14E)-4-[tert-butyl(dimethyl)silyl]oxy-8,14-dimethylhexadeca-10,12,14-trienoate |
|---|---|
| PubChem CID | 134839807 |
| Molecular Formula | C37H55NO5Si |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.38 |
| IUPAC Name | (1-acetyl-2-benzyl-5-oxo-2H-pyrrol-4-yl) (4R,8R,10E,12E,14E)-4-[tert-butyl(dimethyl)silyl]oxy-8,14-dimethylhexadeca-10,12,14-trienoate |
| SMILES | C/C=C(C)/C=C/C=C/C[C@H](C)CCC[C@H](CCC(=O)OC1=CC(Cc2ccccc2)N(C(C)=O)C1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H55NO5Si/c1-10-28(2)18-13-11-14-19-29(3)20-17-23-33(43-44(8,9)37(5,6)7)24-25-35(40)42-34-27-32(38(30(4)39)36(34)41)26-31-21-15-12-16-22-31/h10-16,18,21-22,27,29,32-33H,17,19-20,23-26H2,1-9H3/b14-11+,18-13+,28-10+/t29-,32?,33+/m0/s1 |
| InChIKey | CGELRENZIUJMKB-CHVINYDFSA-N |
| XLogP | 8.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|