C23H40O4Si — CID 134839993
(4S,5R,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxymethyl)-4,5-dimethyl-7a-prop-2-enyl-1,5,6,7-tetrahydroinden-2-one (PubChem CID 134839993) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (4S,5R,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxymethyl)-4,5-dimethyl-7a-prop-2-enyl-1,5,6,7-tetrahydroinden-2-one.
| Compound Name | (4S,5R,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxymethyl)-4,5-dimethyl-7a-prop-2-enyl-1,5,6,7-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 134839993 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (4S,5R,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxymethyl)-4,5-dimethyl-7a-prop-2-enyl-1,5,6,7-tetrahydroinden-2-one |
| SMILES | C=CC[C@@]12CC(=O)C=C1[C@@](C)(COCOC)[C@@H](C)C(O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C23H40O4Si/c1-10-11-23-13-18(24)12-20(23)22(6,15-26-16-25-7)17(2)19(14-23)27-28(8,9)21(3,4)5/h10,12,17,19H,1,11,13-16H2,2-9H3/t17-,19?,22-,23-/m0/s1 |
| InChIKey | QGJDTNFXDQYUCD-OAHSLHIMSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|