C17H15N3O2 — CID 134841163
phenyl 7-pyridin-2-yl-2,7-diazabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 134841163) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is phenyl 7-pyridin-2-yl-2,7-diazabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | phenyl 7-pyridin-2-yl-2,7-diazabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 134841163 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | phenyl 7-pyridin-2-yl-2,7-diazabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CC2C=CC1N2c1ccccn1 |
| InChI | InChI=1S/C17H15N3O2/c21-17(22-14-6-2-1-3-7-14)19-12-13-9-10-16(19)20(13)15-8-4-5-11-18-15/h1-11,13,16H,12H2 |
| InChIKey | DLJXCFPMYIDLBK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|