C26H37NO — CID 134842589
bis(4-tert-butylphenyl)-[(2S)-1-methylpyrrolidin-2-yl]methanol (PubChem CID 134842589) has the molecular formula C26H37NO and a molecular weight of 379.59 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-[(2S)-1-methylpyrrolidin-2-yl]methanol.
| Compound Name | bis(4-tert-butylphenyl)-[(2S)-1-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 134842589 |
| Molecular Formula | C26H37NO |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | bis(4-tert-butylphenyl)-[(2S)-1-methylpyrrolidin-2-yl]methanol |
| SMILES | CN1CCC[C@H]1C(O)(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H37NO/c1-24(2,3)19-10-14-21(15-11-19)26(28,23-9-8-18-27(23)7)22-16-12-20(13-17-22)25(4,5)6/h10-17,23,28H,8-9,18H2,1-7H3/t23-/m0/s1 |
| InChIKey | NYZOYWGUWYSSOI-QHCPKHFHSA-N |
| XLogP | 5.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |