C18H25NO2S — CID 134843917
N-[(1Z)-1-benzylsulfanyl-2-(1-ethoxyethoxy)buta-1,3-dienyl]propan-2-imine (PubChem CID 134843917) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[(1Z)-1-benzylsulfanyl-2-(1-ethoxyethoxy)buta-1,3-dienyl]propan-2-imine.
| Compound Name | N-[(1Z)-1-benzylsulfanyl-2-(1-ethoxyethoxy)buta-1,3-dienyl]propan-2-imine |
|---|---|
| PubChem CID | 134843917 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[(1Z)-1-benzylsulfanyl-2-(1-ethoxyethoxy)buta-1,3-dienyl]propan-2-imine |
| SMILES | C=C/C(OC(C)OCC)=C(\N=C(C)C)SCc1ccccc1 |
| InChI | InChI=1S/C18H25NO2S/c1-6-17(21-15(5)20-7-2)18(19-14(3)4)22-13-16-11-9-8-10-12-16/h6,8-12,15H,1,7,13H2,2-5H3/b18-17- |
| InChIKey | ZIXMCYXNOSPIHP-ZCXUNETKSA-N |
| XLogP | 5.15 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|