C12H21NO2S — CID 25111095
N-[(1Z)-2-(1-ethoxyethoxy)-1-methylsulfanylbuta-1,3-dienyl]propan-2-imine (PubChem CID 25111095) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is N-[(1Z)-2-(1-ethoxyethoxy)-1-methylsulfanylbuta-1,3-dienyl]propan-2-imine.
| Compound Name | N-[(1Z)-2-(1-ethoxyethoxy)-1-methylsulfanylbuta-1,3-dienyl]propan-2-imine |
|---|---|
| PubChem CID | 25111095 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-[(1Z)-2-(1-ethoxyethoxy)-1-methylsulfanylbuta-1,3-dienyl]propan-2-imine |
| SMILES | C=C/C(OC(C)OCC)=C(\N=C(C)C)SC |
| InChI | InChI=1S/C12H21NO2S/c1-7-11(15-10(5)14-8-2)12(16-6)13-9(3)4/h7,10H,1,8H2,2-6H3/b12-11- |
| InChIKey | OBGVZENSJNYECA-QXMHVHEDSA-N |
| XLogP | 3.58 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|