C20H23IO5S — CID 134844358
(2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-5-(iodomethyl)-2-(phenylmethoxymethyl)oxolan-3-ol (PubChem CID 134844358) has the molecular formula C20H23IO5S and a molecular weight of 502.37 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-5-(iodomethyl)-2-(phenylmethoxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-5-(iodomethyl)-2-(phenylmethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 134844358 |
| Molecular Formula | C20H23IO5S |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-5-(iodomethyl)-2-(phenylmethoxymethyl)oxolan-3-ol |
| SMILES | O=S(=O)(C[C@@H]1[C@@H](O)[C@@H](COCc2ccccc2)O[C@@H]1CI)c1ccccc1 |
| InChI | InChI=1S/C20H23IO5S/c21-11-18-17(14-27(23,24)16-9-5-2-6-10-16)20(22)19(26-18)13-25-12-15-7-3-1-4-8-15/h1-10,17-20,22H,11-14H2/t17-,18+,19+,20+/m0/s1 |
| InChIKey | KZKSSQSMKGBKSS-MTQWCTHYSA-N |
| XLogP | 2.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|