C31H55NO5Si2 — CID 134845256
(4R)-4-benzyl-3-[(4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 134845256) has the molecular formula C31H55NO5Si2 and a molecular weight of 577.96 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134845256 |
| Molecular Formula | C31H55NO5Si2 |
| Molecular Weight | 577.96 g/mol |
| Exact Mass | 577.36 |
| IUPAC Name | (4R)-4-benzyl-3-[(4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](CCC(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H55NO5Si2/c1-23(18-19-27(33)32-26(22-35-29(32)34)20-25-16-14-13-15-17-25)28(37-39(11,12)31(6,7)8)24(2)21-36-38(9,10)30(3,4)5/h13-17,23-24,26,28H,18-22H2,1-12H3/t23-,24-,26+,28-/m0/s1 |
| InChIKey | IZJJMTBSPLKVQM-XWZVPRMZSA-N |
| XLogP | 8.04 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.96 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|