C32H57NO5Si2 — CID 134845347
(4R)-4-benzyl-3-[(2R,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 134845347) has the molecular formula C32H57NO5Si2 and a molecular weight of 591.98 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134845347 |
| Molecular Formula | C32H57NO5Si2 |
| Molecular Weight | 591.98 g/mol |
| Exact Mass | 591.38 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C32H57NO5Si2/c1-23(19-24(2)29(34)33-27(22-36-30(33)35)20-26-17-15-14-16-18-26)28(38-40(12,13)32(7,8)9)25(3)21-37-39(10,11)31(4,5)6/h14-18,23-25,27-28H,19-22H2,1-13H3/t23-,24+,25-,27+,28-/m0/s1 |
| InChIKey | TUMGPMRIJDQWKP-FRINSPPISA-N |
| XLogP | 8.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.98 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|