C15H28N+ — CID 134848151
(5R)-3-butyl-5-propyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-4-ium (PubChem CID 134848151) has the molecular formula C15H28N+ and a molecular weight of 222.40 g/mol. Its IUPAC name is (5R)-3-butyl-5-propyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-4-ium.
| Compound Name | (5R)-3-butyl-5-propyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-4-ium |
|---|---|
| PubChem CID | 134848151 |
| Molecular Formula | C15H28N+ |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.22 |
| IUPAC Name | (5R)-3-butyl-5-propyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-4-ium |
| SMILES | CCCCC1=[N+]2C(CCC[C@H]2CCC)CC1 |
| InChI | InChI=1S/C15H28N/c1-3-5-8-14-11-12-15-10-6-9-13(7-4-2)16(14)15/h13,15H,3-12H2,1-2H3/q+1/t13-,15?/m1/s1 |
| InChIKey | YNCOMCNFINEMHW-AFYYWNPRSA-N |
| XLogP | 4.15 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|