C12H19IO — CID 134895331
(4aR,7aS)-2-butyl-3-iodo-4,4a,5,6,7,7a-hexahydrocyclopenta[b]pyran (PubChem CID 134895331) has the molecular formula C12H19IO and a molecular weight of 306.19 g/mol. Its IUPAC name is (4aR,7aS)-2-butyl-3-iodo-4,4a,5,6,7,7a-hexahydrocyclopenta[b]pyran.
| Compound Name | (4aR,7aS)-2-butyl-3-iodo-4,4a,5,6,7,7a-hexahydrocyclopenta[b]pyran |
|---|---|
| PubChem CID | 134895331 |
| Molecular Formula | C12H19IO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | (4aR,7aS)-2-butyl-3-iodo-4,4a,5,6,7,7a-hexahydrocyclopenta[b]pyran |
| SMILES | CCCCC1=C(I)C[C@H]2CCC[C@@H]2O1 |
| InChI | InChI=1S/C12H19IO/c1-2-3-6-12-10(13)8-9-5-4-7-11(9)14-12/h9,11H,2-8H2,1H3/t9-,11+/m1/s1 |
| InChIKey | NDQFAIBKQNAHDQ-KOLCDFICSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|