C12H21IO — CID 15440255
(2S,3R,3aS,7aR)-2-butyl-3-iodo-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran (PubChem CID 15440255) has the molecular formula C12H21IO and a molecular weight of 308.20 g/mol. Its IUPAC name is (2S,3R,3aS,7aR)-2-butyl-3-iodo-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran.
| Compound Name | (2S,3R,3aS,7aR)-2-butyl-3-iodo-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
|---|---|
| PubChem CID | 15440255 |
| Molecular Formula | C12H21IO |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (2S,3R,3aS,7aR)-2-butyl-3-iodo-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
| SMILES | CCCC[C@@H]1O[C@@H]2CCCC[C@@H]2[C@H]1I |
| InChI | InChI=1S/C12H21IO/c1-2-3-7-11-12(13)9-6-4-5-8-10(9)14-11/h9-12H,2-8H2,1H3/t9-,10+,11-,12+/m0/s1 |
| InChIKey | MZOQCZLUJMSQOF-WHOHXGKFSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|