C12H22O2 — CID 85299411
2-butyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol (PubChem CID 85299411) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-butyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol.
| Compound Name | 2-butyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 85299411 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-butyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-ol |
| SMILES | CCCCC1OC2CCCCC2C1O |
| InChI | InChI=1S/C12H22O2/c1-2-3-7-11-12(13)9-6-4-5-8-10(9)14-11/h9-13H,2-8H2,1H3 |
| InChIKey | CERDIFANDRHJLT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |