C16H18O3S — CID 134848225
(1R,2S,5S,6R,7S)-5-(benzenesulfonyl)-7-methyl-10-oxatricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 134848225) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is (1R,2S,5S,6R,7S)-5-(benzenesulfonyl)-7-methyl-10-oxatricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | (1R,2S,5S,6R,7S)-5-(benzenesulfonyl)-7-methyl-10-oxatricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 134848225 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (1R,2S,5S,6R,7S)-5-(benzenesulfonyl)-7-methyl-10-oxatricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | C[C@@]12CC[C@@H](O1)[C@H]1C=C[C@H](S(=O)(=O)c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C16H18O3S/c1-16-10-9-13(19-16)12-7-8-14(15(12)16)20(17,18)11-5-3-2-4-6-11/h2-8,12-15H,9-10H2,1H3/t12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | IONBJRKGHJHBND-OWYFMNJBSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|