C32H51NO5Si2 — CID 134850811
(3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[2-hydroxy-2-(4-methoxyphenyl)ethyl]pyrrolidin-2-one (PubChem CID 134850811) has the molecular formula C32H51NO5Si2 and a molecular weight of 585.93 g/mol. Its IUPAC name is (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[2-hydroxy-2-(4-methoxyphenyl)ethyl]pyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[2-hydroxy-2-(4-methoxyphenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134850811 |
| Molecular Formula | C32H51NO5Si2 |
| Molecular Weight | 585.93 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[2-hydroxy-2-(4-methoxyphenyl)ethyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C(O)C[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H51NO5Si2/c1-31(2,3)39(8,9)37-28-26(21-27(34)24-17-19-25(36-7)20-18-24)33(22-23-15-13-12-14-16-23)30(35)29(28)38-40(10,11)32(4,5)6/h12-20,26-29,34H,21-22H2,1-11H3/t26-,27?,28+,29-/m1/s1 |
| InChIKey | HCXJWZHYEKDTDB-IGDXEPPTSA-N |
| XLogP | 7.31 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.93 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|