C24H21NO — CID 134851984
(2E,4E)-N-(4-methoxyphenyl)-1,5-diphenylpenta-2,4-dien-1-imine (PubChem CID 134851984) has the molecular formula C24H21NO and a molecular weight of 339.44 g/mol. Its IUPAC name is (2E,4E)-N-(4-methoxyphenyl)-1,5-diphenylpenta-2,4-dien-1-imine.
| Compound Name | (2E,4E)-N-(4-methoxyphenyl)-1,5-diphenylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 134851984 |
| Molecular Formula | C24H21NO |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (2E,4E)-N-(4-methoxyphenyl)-1,5-diphenylpenta-2,4-dien-1-imine |
| SMILES | COc1ccc(/N=C(\C=C\C=C\c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO/c1-26-23-18-16-22(17-19-23)25-24(21-13-6-3-7-14-21)15-9-8-12-20-10-4-2-5-11-20/h2-19H,1H3/b12-8+,15-9+,25-24+ |
| InChIKey | SIZMCCSRMLQGJN-KYNJCZABSA-N |
| XLogP | 6.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|