C18H16N4O3S2 — CID 40541247
5-[[(E)-3-(4-methoxyphenyl)-1-phenylprop-2-enylidene]amino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 40541247) has the molecular formula C18H16N4O3S2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 5-[[(E)-3-(4-methoxyphenyl)-1-phenylprop-2-enylidene]amino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[[(E)-3-(4-methoxyphenyl)-1-phenylprop-2-enylidene]amino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 40541247 |
| Molecular Formula | C18H16N4O3S2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 5-[[(E)-3-(4-methoxyphenyl)-1-phenylprop-2-enylidene]amino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | COc1ccc(/C=C/C(=Nc2nnc(S(N)(=O)=O)s2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N4O3S2/c1-25-15-10-7-13(8-11-15)9-12-16(14-5-3-2-4-6-14)20-17-21-22-18(26-17)27(19,23)24/h2-12H,1H3,(H2,19,23,24)/b12-9+,20-16? |
| InChIKey | NZUSXQJRNVABQE-GPBTZJJPSA-N |
| XLogP | 3.03 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|