C25H28O2Si — CID 134852061
(3S,3aR,7aR)-7a-benzyl-3-[1-[dimethyl(phenyl)silyl]ethenyl]-2,3,3a,4-tetrahydro-1-benzofuran-5-one (PubChem CID 134852061) has the molecular formula C25H28O2Si and a molecular weight of 388.58 g/mol. Its IUPAC name is (3S,3aR,7aR)-7a-benzyl-3-[1-[dimethyl(phenyl)silyl]ethenyl]-2,3,3a,4-tetrahydro-1-benzofuran-5-one.
| Compound Name | (3S,3aR,7aR)-7a-benzyl-3-[1-[dimethyl(phenyl)silyl]ethenyl]-2,3,3a,4-tetrahydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 134852061 |
| Molecular Formula | C25H28O2Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (3S,3aR,7aR)-7a-benzyl-3-[1-[dimethyl(phenyl)silyl]ethenyl]-2,3,3a,4-tetrahydro-1-benzofuran-5-one |
| SMILES | C=C([C@@H]1CO[C@]2(Cc3ccccc3)C=CC(=O)C[C@H]12)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H28O2Si/c1-19(28(2,3)22-12-8-5-9-13-22)23-18-27-25(15-14-21(26)16-24(23)25)17-20-10-6-4-7-11-20/h4-15,23-24H,1,16-18H2,2-3H3/t23-,24+,25-/m0/s1 |
| InChIKey | OPDJWWWREFLCMO-GVAUOCQISA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|