C19H24O2Si — CID 132565886
(3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-methyl-2,3,3a,4-tetrahydro-1-benzofuran-5-one (PubChem CID 132565886) has the molecular formula C19H24O2Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-methyl-2,3,3a,4-tetrahydro-1-benzofuran-5-one.
| Compound Name | (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-methyl-2,3,3a,4-tetrahydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 132565886 |
| Molecular Formula | C19H24O2Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-methyl-2,3,3a,4-tetrahydro-1-benzofuran-5-one |
| SMILES | C=C([C@@H]1CO[C@]2(C)C=CC(=O)C[C@H]12)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H24O2Si/c1-14(22(3,4)16-8-6-5-7-9-16)17-13-21-19(2)11-10-15(20)12-18(17)19/h5-11,17-18H,1,12-13H2,2-4H3/t17-,18+,19+/m0/s1 |
| InChIKey | ZTOHXPIGGXFKJR-IPMKNSEASA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|