C18H20N2O2 — CID 134852871
(3E,5E)-6-(1,3-benzodioxol-5-yl)-2-piperidin-1-ylhexa-3,5-dienenitrile (PubChem CID 134852871) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3E,5E)-6-(1,3-benzodioxol-5-yl)-2-piperidin-1-ylhexa-3,5-dienenitrile.
| Compound Name | (3E,5E)-6-(1,3-benzodioxol-5-yl)-2-piperidin-1-ylhexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 134852871 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3E,5E)-6-(1,3-benzodioxol-5-yl)-2-piperidin-1-ylhexa-3,5-dienenitrile |
| SMILES | N#CC(/C=C/C=C/c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C18H20N2O2/c19-13-16(20-10-4-1-5-11-20)7-3-2-6-15-8-9-17-18(12-15)22-14-21-17/h2-3,6-9,12,16H,1,4-5,10-11,14H2/b6-2+,7-3+ |
| InChIKey | LAQFGSOSGGTMLI-YPCIICBESA-N |
| XLogP | 3.36 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|