C12H15LiO4 — CID 134854687
lithium 2-(2,5-dimethoxybenzene-6-id-1-yl)-1,3-dioxane (PubChem CID 134854687) has the molecular formula C12H15LiO4 and a molecular weight of 230.19 g/mol. Its IUPAC name is lithium 2-(2,5-dimethoxybenzene-6-id-1-yl)-1,3-dioxane.
| Compound Name | lithium 2-(2,5-dimethoxybenzene-6-id-1-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 134854687 |
| Molecular Formula | C12H15LiO4 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | lithium 2-(2,5-dimethoxybenzene-6-id-1-yl)-1,3-dioxane |
| SMILES | COc1[c-]c(C2OCCCO2)c(OC)cc1.[Li+] |
| InChI | InChI=1S/C12H15O4.Li/c1-13-9-4-5-11(14-2)10(8-9)12-15-6-3-7-16-12;/h4-5,12H,3,6-7H2,1-2H3;/q-1;+1 |
| InChIKey | UTGMJPTXIKFHBH-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|