C12H16O3 — CID 134855522
5-[(3E)-1-hydroxy-4-methylhexa-3,5-dienyl]-5-methylfuran-2-one (PubChem CID 134855522) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-[(3E)-1-hydroxy-4-methylhexa-3,5-dienyl]-5-methylfuran-2-one.
| Compound Name | 5-[(3E)-1-hydroxy-4-methylhexa-3,5-dienyl]-5-methylfuran-2-one |
|---|---|
| PubChem CID | 134855522 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 5-[(3E)-1-hydroxy-4-methylhexa-3,5-dienyl]-5-methylfuran-2-one |
| SMILES | C=C/C(C)=C/CC(O)C1(C)C=CC(=O)O1 |
| InChI | InChI=1S/C12H16O3/c1-4-9(2)5-6-10(13)12(3)8-7-11(14)15-12/h4-5,7-8,10,13H,1,6H2,2-3H3/b9-5+ |
| InChIKey | BMRUUHWSFKYGMN-WEVVVXLNSA-N |
| XLogP | 1.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|